C14H2F12O — CID 15210912
1,2,3,4,5-pentafluoro-6-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]methyl]benzene (PubChem CID 15210912) has the molecular formula C14H2F12O and a molecular weight of 414.15 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]methyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 15210912 |
| Molecular Formula | C14H2F12O |
| Molecular Weight | 414.15 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]methyl]benzene |
| SMILES | Fc1c(F)c(F)c(COc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H2F12O/c15-4-2(5(16)9(20)10(21)8(4)19)1-27-13-11(22)6(17)3(14(24,25)26)7(18)12(13)23/h1H2 |
| InChIKey | ZTLHEMNTSRINNE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.15 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|