C14H3F19O — CID 15210911
1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene (PubChem CID 15210911) has the molecular formula C14H3F19O and a molecular weight of 548.14 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene.
| Compound Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 15210911 |
| Molecular Formula | C14H3F19O |
| Molecular Weight | 548.14 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H3F19O/c15-3-2(11(25,26)27)4(16)6(18)7(5(3)17)34-1-9(21,22)12(28,29)14(32,33)13(30,31)10(23,24)8(19)20/h8H,1H2 |
| InChIKey | BLRWFRIQBCQUNS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.14 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|