C10F13KO3S — CID 141230624
potassium 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)benzenesulfonate (PubChem CID 141230624) has the molecular formula C10F13KO3S and a molecular weight of 486.25 g/mol. Its IUPAC name is potassium 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)benzenesulfonate.
| Compound Name | potassium 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)benzenesulfonate |
|---|---|
| PubChem CID | 141230624 |
| Molecular Formula | C10F13KO3S |
| Molecular Weight | 486.25 g/mol |
| Exact Mass | 485.90 |
| IUPAC Name | potassium 2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C10HF13O3S.K/c11-2-1(6(27(24,25)26)5(14)4(13)3(2)12)7(15,16)8(17,18)9(19,20)10(21,22)23;/h(H,24,25,26);/q;+1/p-1 |
| InChIKey | SQKFLJSLQKREDL-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|