C18H8Cl2F5IO3S — CID 22389958
bis(4-chlorophenyl)iodanium;2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 22389958) has the molecular formula C18H8Cl2F5IO3S and a molecular weight of 597.13 g/mol. Its IUPAC name is bis(4-chlorophenyl)iodanium;2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | bis(4-chlorophenyl)iodanium;2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 22389958 |
| Molecular Formula | C18H8Cl2F5IO3S |
| Molecular Weight | 597.13 g/mol |
| Exact Mass | 595.85 |
| IUPAC Name | bis(4-chlorophenyl)iodanium;2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | Clc1ccc([I+]c2ccc(Cl)cc2)cc1.O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H8Cl2I.C6HF5O3S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h1-8H;(H,12,13,14)/q+1;/p-1 |
| InChIKey | ZVTCMJHJERKZOM-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|