C24H15F5O5S2 — CID 23133190
bis(4-hydroxyphenyl)-phenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 23133190) has the molecular formula C24H15F5O5S2 and a molecular weight of 542.50 g/mol. Its IUPAC name is bis(4-hydroxyphenyl)-phenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | bis(4-hydroxyphenyl)-phenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 23133190 |
| Molecular Formula | C24H15F5O5S2 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | bis(4-hydroxyphenyl)-phenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F.Oc1ccc([S+](c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H14O2S.C6HF5O3S/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h1-13H,(H-,19,20);(H,12,13,14) |
| InChIKey | FVYBNHSJOKQZLD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|