C18H15F6O2PS — CID 23132993
bis(4-hydroxyphenyl)-phenylsulfanium hexafluorophosphate (PubChem CID 23132993) has the molecular formula C18H15F6O2PS and a molecular weight of 440.35 g/mol. Its IUPAC name is bis(4-hydroxyphenyl)-phenylsulfanium hexafluorophosphate.
| Compound Name | bis(4-hydroxyphenyl)-phenylsulfanium hexafluorophosphate |
|---|---|
| PubChem CID | 23132993 |
| Molecular Formula | C18H15F6O2PS |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | bis(4-hydroxyphenyl)-phenylsulfanium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.Oc1ccc([S+](c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H14O2S.F6P/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18;1-7(2,3,4,5)6/h1-13H,(H-,19,20);/q;-1/p+1 |
| InChIKey | NXLPKZDZTIPJCM-UHFFFAOYSA-O |
| XLogP | 7.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|