C18H15O2S+ — CID 22057240
(2,4-dihydroxyphenyl)-diphenylsulfanium (PubChem CID 22057240) has the molecular formula C18H15O2S+ and a molecular weight of 295.38 g/mol. Its IUPAC name is (2,4-dihydroxyphenyl)-diphenylsulfanium.
| Compound Name | (2,4-dihydroxyphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 22057240 |
| Molecular Formula | C18H15O2S+ |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (2,4-dihydroxyphenyl)-diphenylsulfanium |
| SMILES | Oc1ccc([S+](c2ccccc2)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C18H14O2S/c19-14-11-12-18(17(20)13-14)21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13H,(H-,19,20)/p+1 |
| InChIKey | NPOKDFJMZIELNR-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|