C22H23F6O4PS — CID 141214793
bis[4-(2-hydroxyethoxy)phenyl]-phenylsulfanium hexafluorophosphate (PubChem CID 141214793) has the molecular formula C22H23F6O4PS and a molecular weight of 528.45 g/mol. Its IUPAC name is bis[4-(2-hydroxyethoxy)phenyl]-phenylsulfanium hexafluorophosphate.
| Compound Name | bis[4-(2-hydroxyethoxy)phenyl]-phenylsulfanium hexafluorophosphate |
|---|---|
| PubChem CID | 141214793 |
| Molecular Formula | C22H23F6O4PS |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | bis[4-(2-hydroxyethoxy)phenyl]-phenylsulfanium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.OCCOc1ccc([S+](c2ccccc2)c2ccc(OCCO)cc2)cc1 |
| InChI | InChI=1S/C22H23O4S.F6P/c23-14-16-25-18-6-10-21(11-7-18)27(20-4-2-1-3-5-20)22-12-8-19(9-13-22)26-17-15-24;1-7(2,3,4,5)6/h1-13,23-24H,14-17H2;/q+1;-1 |
| InChIKey | ZRILVUYKKXFVGX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|