C36H42F2O6S2 — CID 22057262
2,6-difluorobenzenesulfonate;diphenyl-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium (PubChem CID 22057262) has the molecular formula C36H42F2O6S2 and a molecular weight of 672.86 g/mol. Its IUPAC name is 2,6-difluorobenzenesulfonate;diphenyl-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium.
| Compound Name | 2,6-difluorobenzenesulfonate;diphenyl-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 22057262 |
| Molecular Formula | C36H42F2O6S2 |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | 2,6-difluorobenzenesulfonate;diphenyl-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium |
| SMILES | CC(C)(C)Oc1cc(OC(C)(C)C)c([S+](c2ccccc2)c2ccccc2)c(OC(C)(C)C)c1.O=S(=O)([O-])c1c(F)cccc1F |
| InChI | InChI=1S/C30H39O3S.C6H4F2O3S/c1-28(2,3)31-22-20-25(32-29(4,5)6)27(26(21-22)33-30(7,8)9)34(23-16-12-10-13-17-23)24-18-14-11-15-19-24;7-4-2-1-3-5(8)6(4)12(9,10)11/h10-21H,1-9H3;1-3H,(H,9,10,11)/q+1;/p-1 |
| InChIKey | CPEHPDKLVQWMKE-UHFFFAOYSA-M |
| XLogP | 9.18 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|