C23H23F3O4S2 — CID 15766607
[[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-lambda4-sulfanyl] trifluoromethanesulfonate (PubChem CID 15766607) has the molecular formula C23H23F3O4S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is [[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-lambda4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-lambda4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15766607 |
| Molecular Formula | C23H23F3O4S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | [[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenyl-lambda4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)Oc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23F3O4S2/c1-22(2,3)29-18-14-16-21(17-15-18)31(19-10-6-4-7-11-19,20-12-8-5-9-13-20)30-32(27,28)23(24,25)26/h4-17H,1-3H3 |
| InChIKey | OAUZXDMFBRIILQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|