C15H13FO4S — CID 10781106
2-fluoro-3-propan-2-yloxyphenoxathiine 10,10-dioxide (PubChem CID 10781106) has the molecular formula C15H13FO4S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-fluoro-3-propan-2-yloxyphenoxathiine 10,10-dioxide.
| Compound Name | 2-fluoro-3-propan-2-yloxyphenoxathiine 10,10-dioxide |
|---|---|
| PubChem CID | 10781106 |
| Molecular Formula | C15H13FO4S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-fluoro-3-propan-2-yloxyphenoxathiine 10,10-dioxide |
| SMILES | CC(C)Oc1cc2c(cc1F)S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C15H13FO4S/c1-9(2)19-12-8-13-15(7-10(12)16)21(17,18)14-6-4-3-5-11(14)20-13/h3-9H,1-2H3 |
| InChIKey | SVZACTQBMHTFPV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |