C14H12O4S — CID 10564394
1-ethoxyphenoxathiine 10,10-dioxide (PubChem CID 10564394) has the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-ethoxyphenoxathiine 10,10-dioxide.
| Compound Name | 1-ethoxyphenoxathiine 10,10-dioxide |
|---|---|
| PubChem CID | 10564394 |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-ethoxyphenoxathiine 10,10-dioxide |
| SMILES | CCOc1cccc2c1S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C14H12O4S/c1-2-17-11-7-5-8-12-14(11)19(15,16)13-9-4-3-6-10(13)18-12/h3-9H,2H2,1H3 |
| InChIKey | VVIYUPUZHWUDQW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |