C38H38Cl2N4O4 — CID 22899489
2-[3-[[5-[3-[[(2-chloroacetyl)amino]methyl]-2,4,6-trimethylanilino]-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylphenyl]-N-(chloromethyl)acetamide (PubChem CID 22899489) has the molecular formula C38H38Cl2N4O4 and a molecular weight of 685.65 g/mol. Its IUPAC name is 2-[3-[[5-[3-[[(2-chloroacetyl)amino]methyl]-2,4,6-trimethylanilino]-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylphenyl]-N-(chloromethyl)acetamide.
| Compound Name | 2-[3-[[5-[3-[[(2-chloroacetyl)amino]methyl]-2,4,6-trimethylanilino]-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylphenyl]-N-(chloromethyl)acetamide |
|---|---|
| PubChem CID | 22899489 |
| Molecular Formula | C38H38Cl2N4O4 |
| Molecular Weight | 685.65 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 2-[3-[[5-[3-[[(2-chloroacetyl)amino]methyl]-2,4,6-trimethylanilino]-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylphenyl]-N-(chloromethyl)acetamide |
| SMILES | Cc1cc(C)c(Nc2cccc3c2C(=O)c2cccc(Nc4c(C)cc(C)c(CC(=O)NCCl)c4C)c2C3=O)c(C)c1CNC(=O)CCl |
| InChI | InChI=1S/C38H38Cl2N4O4/c1-19-13-21(3)35(23(5)27(19)15-31(45)42-18-40)43-29-11-7-9-25-33(29)37(47)26-10-8-12-30(34(26)38(25)48)44-36-22(4)14-20(2)28(24(36)6)17-41-32(46)16-39/h7-14,43-44H,15-18H2,1-6H3,(H,41,46)(H,42,45) |
| InChIKey | SFVKDLXPZCLYJJ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.65 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|