C11H8O6S2-2 — CID 169293338
5-methyl-7-oxidoperoxysulfanylnaphthalene-2-sulfonate (PubChem CID 169293338) has the molecular formula C11H8O6S2-2 and a molecular weight of 300.31 g/mol. Its IUPAC name is 5-methyl-7-oxidoperoxysulfanylnaphthalene-2-sulfonate.
| Compound Name | 5-methyl-7-oxidoperoxysulfanylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 169293338 |
| Molecular Formula | C11H8O6S2-2 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 5-methyl-7-oxidoperoxysulfanylnaphthalene-2-sulfonate |
| SMILES | Cc1cc(SOO[O-])cc2cc(S(=O)(=O)[O-])ccc12 |
| InChI | InChI=1S/C11H10O6S2/c1-7-4-9(18-17-16-12)5-8-6-10(19(13,14)15)2-3-11(7)8/h2-6,12H,1H3,(H,13,14,15)/p-2 |
| InChIKey | XIBUDCQRRZVHLM-UHFFFAOYSA-L |
| XLogP | 1.28 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|