C13H11NNa2O6S3 — CID 20727822
disodium;4-(ethanethioylamino)-5-methyl-7-oxidoperoxysulfanylnaphthalene-2-sulfonate (PubChem CID 20727822) has the molecular formula C13H11NNa2O6S3 and a molecular weight of 419.41 g/mol. Its IUPAC name is disodium;4-(ethanethioylamino)-5-methyl-7-oxidoperoxysulfanylnaphthalene-2-sulfonate.
| Compound Name | disodium;4-(ethanethioylamino)-5-methyl-7-oxidoperoxysulfanylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 20727822 |
| Molecular Formula | C13H11NNa2O6S3 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 418.95 |
| IUPAC Name | disodium;4-(ethanethioylamino)-5-methyl-7-oxidoperoxysulfanylnaphthalene-2-sulfonate |
| SMILES | CC(=S)Nc1cc(S(=O)(=O)[O-])cc2cc(SOO[O-])cc(C)c12.[Na+].[Na+] |
| InChI | InChI=1S/C13H13NO6S3.2Na/c1-7-3-10(22-20-19-15)4-9-5-11(23(16,17)18)6-12(13(7)9)14-8(2)21;;/h3-6,15H,1-2H3,(H,14,21)(H,16,17,18);;/q;2*+1/p-2 |
| InChIKey | YPMDCRMJVVZGKT-UHFFFAOYSA-L |
| XLogP | -3.95 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|