C17H9Cl2NNa2O8S2 — CID 20578286
disodium;5-[(3,4-dichlorobenzoyl)amino]-4-hydroxy-7-oxidoperoxysulfanylnaphthalene-2-sulfonate (PubChem CID 20578286) has the molecular formula C17H9Cl2NNa2O8S2 and a molecular weight of 536.28 g/mol. Its IUPAC name is disodium;5-[(3,4-dichlorobenzoyl)amino]-4-hydroxy-7-oxidoperoxysulfanylnaphthalene-2-sulfonate.
| Compound Name | disodium;5-[(3,4-dichlorobenzoyl)amino]-4-hydroxy-7-oxidoperoxysulfanylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 20578286 |
| Molecular Formula | C17H9Cl2NNa2O8S2 |
| Molecular Weight | 536.28 g/mol |
| Exact Mass | 534.89 |
| IUPAC Name | disodium;5-[(3,4-dichlorobenzoyl)amino]-4-hydroxy-7-oxidoperoxysulfanylnaphthalene-2-sulfonate |
| SMILES | O=C(Nc1cc(SOO[O-])cc2cc(S(=O)(=O)[O-])cc(O)c12)c1ccc(Cl)c(Cl)c1.[Na+].[Na+] |
| InChI | InChI=1S/C17H11Cl2NO8S2.2Na/c18-12-2-1-8(5-13(12)19)17(22)20-14-6-10(29-28-27-23)3-9-4-11(30(24,25)26)7-15(21)16(9)14;;/h1-7,21,23H,(H,20,22)(H,24,25,26);;/q;2*+1/p-2 |
| InChIKey | WGXCJWLNTNIGJC-UHFFFAOYSA-L |
| XLogP | -2.75 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.28 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|