C10H7NNa2O7S2 — CID 23553841
disodium;5-amino-4-hydroxy-7-oxidoperoxysulfanylnaphthalene-2-sulfonate (PubChem CID 23553841) has the molecular formula C10H7NNa2O7S2 and a molecular weight of 363.28 g/mol. Its IUPAC name is disodium;5-amino-4-hydroxy-7-oxidoperoxysulfanylnaphthalene-2-sulfonate.
| Compound Name | disodium;5-amino-4-hydroxy-7-oxidoperoxysulfanylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 23553841 |
| Molecular Formula | C10H7NNa2O7S2 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | disodium;5-amino-4-hydroxy-7-oxidoperoxysulfanylnaphthalene-2-sulfonate |
| SMILES | Nc1cc(SOO[O-])cc2cc(S(=O)(=O)[O-])cc(O)c12.[Na+].[Na+] |
| InChI | InChI=1S/C10H9NO7S2.2Na/c11-8-3-6(19-18-17-13)1-5-2-7(20(14,15)16)4-9(12)10(5)8;;/h1-4,12-13H,11H2,(H,14,15,16);;/q;2*+1/p-2 |
| InChIKey | COPIGVXLFHHJLE-UHFFFAOYSA-L |
| XLogP | -5.73 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | -5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|