C10H9NO4S2 — CID 143211913
5-amino-4-hydroxy-7-sulfanylnaphthalene-2-sulfonic acid (PubChem CID 143211913) has the molecular formula C10H9NO4S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-amino-4-hydroxy-7-sulfanylnaphthalene-2-sulfonic acid.
| Compound Name | 5-amino-4-hydroxy-7-sulfanylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 143211913 |
| Molecular Formula | C10H9NO4S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 5-amino-4-hydroxy-7-sulfanylnaphthalene-2-sulfonic acid |
| SMILES | Nc1cc(S)cc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C10H9NO4S2/c11-8-3-6(16)1-5-2-7(17(13,14)15)4-9(12)10(5)8/h1-4,12,16H,11H2,(H,13,14,15) |
| InChIKey | RLDFNPMECNRBJO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|