C18H20N2O8S2 — CID 88802837
4-amino-5-hydroxynaphthalene-2,7-disulfonic acid;N-methoxy-3-methylaniline (PubChem CID 88802837) has the molecular formula C18H20N2O8S2 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid;N-methoxy-3-methylaniline.
| Compound Name | 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid;N-methoxy-3-methylaniline |
|---|---|
| PubChem CID | 88802837 |
| Molecular Formula | C18H20N2O8S2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid;N-methoxy-3-methylaniline |
| SMILES | CONc1cccc(C)c1.Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C10H9NO7S2.C8H11NO/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8;1-7-4-3-5-8(6-7)9-10-2/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);3-6,9H,1-2H3 |
| InChIKey | XIMBKTPPRKNJKU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|