C11H11NO7S2 — CID 163932111
4-amino-5-hydroxy-7-(sulfomethyl)naphthalene-2-sulfonic acid (PubChem CID 163932111) has the molecular formula C11H11NO7S2 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-amino-5-hydroxy-7-(sulfomethyl)naphthalene-2-sulfonic acid.
| Compound Name | 4-amino-5-hydroxy-7-(sulfomethyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 163932111 |
| Molecular Formula | C11H11NO7S2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 4-amino-5-hydroxy-7-(sulfomethyl)naphthalene-2-sulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(CS(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C11H11NO7S2/c12-9-4-8(21(17,18)19)3-7-1-6(5-20(14,15)16)2-10(13)11(7)9/h1-4,13H,5,12H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | RJOHAWRHWIBUPV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|