C13H15NO7S2 — CID 56973887
7-amino-4-hydroxy-5-(2-sulfopropan-2-yl)naphthalene-2-sulfonic acid (PubChem CID 56973887) has the molecular formula C13H15NO7S2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 7-amino-4-hydroxy-5-(2-sulfopropan-2-yl)naphthalene-2-sulfonic acid.
| Compound Name | 7-amino-4-hydroxy-5-(2-sulfopropan-2-yl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 56973887 |
| Molecular Formula | C13H15NO7S2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 7-amino-4-hydroxy-5-(2-sulfopropan-2-yl)naphthalene-2-sulfonic acid |
| SMILES | CC(C)(c1cc(N)cc2cc(S(=O)(=O)O)cc(O)c12)S(=O)(=O)O |
| InChI | InChI=1S/C13H15NO7S2/c1-13(2,23(19,20)21)10-5-8(14)3-7-4-9(22(16,17)18)6-11(15)12(7)10/h3-6,15H,14H2,1-2H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | NSJHEAYBFCMVFB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|