C21H26N2O7S2 — CID 88815283
4-amino-5-hydroxynaphthalene-2,7-disulfonic acid;N,N-diethyl-3-methylaniline (PubChem CID 88815283) has the molecular formula C21H26N2O7S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid;N,N-diethyl-3-methylaniline.
| Compound Name | 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid;N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 88815283 |
| Molecular Formula | C21H26N2O7S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid;N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1cccc(C)c1.Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C11H17N.C10H9NO7S2/c1-4-12(5-2)11-8-6-7-10(3)9-11;11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8/h6-9H,4-5H2,1-3H3;1-4,12H,11H2,(H,13,14,15)(H,16,17,18) |
| InChIKey | JQGPYDJCRUPWTK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|