C20H25NO5S — CID 162715244
3-[2-[(N-ethyl-3-methylanilino)methyl]-3-methyl-5-sulfophenyl]propanoic acid (PubChem CID 162715244) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is 3-[2-[(N-ethyl-3-methylanilino)methyl]-3-methyl-5-sulfophenyl]propanoic acid.
| Compound Name | 3-[2-[(N-ethyl-3-methylanilino)methyl]-3-methyl-5-sulfophenyl]propanoic acid |
|---|---|
| PubChem CID | 162715244 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-[2-[(N-ethyl-3-methylanilino)methyl]-3-methyl-5-sulfophenyl]propanoic acid |
| SMILES | CCN(Cc1c(C)cc(S(=O)(=O)O)cc1CCC(=O)O)c1cccc(C)c1 |
| InChI | InChI=1S/C20H25NO5S/c1-4-21(17-7-5-6-14(2)10-17)13-19-15(3)11-18(27(24,25)26)12-16(19)8-9-20(22)23/h5-7,10-12H,4,8-9,13H2,1-3H3,(H,22,23)(H,24,25,26) |
| InChIKey | WDDHTHDLXITIED-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|