C24H29ClN2O4S — CID 88812266
2-chloro-4-ethoxyaniline;3-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid (PubChem CID 88812266) has the molecular formula C24H29ClN2O4S and a molecular weight of 477.03 g/mol. Its IUPAC name is 2-chloro-4-ethoxyaniline;3-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid.
| Compound Name | 2-chloro-4-ethoxyaniline;3-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 88812266 |
| Molecular Formula | C24H29ClN2O4S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-chloro-4-ethoxyaniline;3-[(N-ethyl-3-methylanilino)methyl]benzenesulfonic acid |
| SMILES | CCN(Cc1cccc(S(=O)(=O)O)c1)c1cccc(C)c1.CCOc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C16H19NO3S.C8H10ClNO/c1-3-17(15-8-4-6-13(2)10-15)12-14-7-5-9-16(11-14)21(18,19)20;1-2-11-6-3-4-8(10)7(9)5-6/h4-11H,3,12H2,1-2H3,(H,18,19,20);3-5H,2,10H2,1H3 |
| InChIKey | VWNUXDXZDNUGOD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|