C23H22F3N3O3S — CID 163437734
3-[[N-ethyl-3-methyl-4-[[2-(trifluoromethyl)phenyl]diazenyl]anilino]methyl]benzenesulfonic acid (PubChem CID 163437734) has the molecular formula C23H22F3N3O3S and a molecular weight of 477.51 g/mol. Its IUPAC name is 3-[[N-ethyl-3-methyl-4-[[2-(trifluoromethyl)phenyl]diazenyl]anilino]methyl]benzenesulfonic acid.
| Compound Name | 3-[[N-ethyl-3-methyl-4-[[2-(trifluoromethyl)phenyl]diazenyl]anilino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 163437734 |
| Molecular Formula | C23H22F3N3O3S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 3-[[N-ethyl-3-methyl-4-[[2-(trifluoromethyl)phenyl]diazenyl]anilino]methyl]benzenesulfonic acid |
| SMILES | CCN(Cc1cccc(S(=O)(=O)O)c1)c1ccc(/N=N/c2ccccc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C23H22F3N3O3S/c1-3-29(15-17-7-6-8-19(14-17)33(30,31)32)18-11-12-21(16(2)13-18)27-28-22-10-5-4-9-20(22)23(24,25)26/h4-14H,3,15H2,1-2H3,(H,30,31,32)/b28-27+ |
| InChIKey | AVXMTEMFPZCQJZ-BYYHNAKLSA-N |
| XLogP | 6.70 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|