C42H46N4NaO6S2+ — CID 54607511
sodium 3-[[4-[cyano-[4-(diethylamino)phenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-N-ethylanilino]methyl]benzenesulfonic acid (PubChem CID 54607511) has the molecular formula C42H46N4NaO6S2+ and a molecular weight of 789.98 g/mol. Its IUPAC name is sodium 3-[[4-[cyano-[4-(diethylamino)phenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-N-ethylanilino]methyl]benzenesulfonic acid.
| Compound Name | sodium 3-[[4-[cyano-[4-(diethylamino)phenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-N-ethylanilino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54607511 |
| Molecular Formula | C42H46N4NaO6S2+ |
| Molecular Weight | 789.98 g/mol |
| Exact Mass | 789.28 |
| IUPAC Name | sodium 3-[[4-[cyano-[4-(diethylamino)phenyl]-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-N-ethylanilino]methyl]benzenesulfonic acid |
| SMILES | CCN(CC)c1ccc(C(C#N)(c2ccc(N(CC)Cc3cccc(S(=O)(=O)O)c3)cc2)c2ccc(N(CC)Cc3cccc(S(=O)(=O)O)c3)cc2)cc1.[Na+] |
| InChI | InChI=1S/C42H46N4O6S2.Na/c1-5-44(6-2)37-21-15-34(16-22-37)42(31-43,35-17-23-38(24-18-35)45(7-3)29-32-11-9-13-40(27-32)53(47,48)49)36-19-25-39(26-20-36)46(8-4)30-33-12-10-14-41(28-33)54(50,51)52;/h9-28H,5-8,29-30H2,1-4H3,(H,47,48,49)(H,50,51,52);/q;+1 |
| InChIKey | DQHWHKQUBXCZHQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 142.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|