C20H18N2O14S4 — CID 158624379
4-amino-5-hydroxynaphthalene-1,7-disulfonic acid;5-amino-4-hydroxynaphthalene-2-sulfonic acid;sulfur trioxide (PubChem CID 158624379) has the molecular formula C20H18N2O14S4 and a molecular weight of 638.63 g/mol. Its IUPAC name is 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid;5-amino-4-hydroxynaphthalene-2-sulfonic acid;sulfur trioxide.
| Compound Name | 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid;5-amino-4-hydroxynaphthalene-2-sulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 158624379 |
| Molecular Formula | C20H18N2O14S4 |
| Molecular Weight | 638.63 g/mol |
| Exact Mass | 637.96 |
| IUPAC Name | 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid;5-amino-4-hydroxynaphthalene-2-sulfonic acid;sulfur trioxide |
| SMILES | Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(O)c12.Nc1cccc2cc(S(=O)(=O)O)cc(O)c12.O=S(=O)=O |
| InChI | InChI=1S/C10H9NO7S2.C10H9NO4S.O3S/c11-7-1-2-9(20(16,17)18)6-3-5(19(13,14)15)4-8(12)10(6)7;11-8-3-1-2-6-4-7(16(13,14)15)5-9(12)10(6)8;1-4(2)3/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);1-5,12H,11H2,(H,13,14,15); |
| InChIKey | HYKFQZNXOSWGNZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 306.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.63 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|