C11H11NO7S2 — CID 157451766
5-amino-4-methoxynaphthalene-2-sulfonic acid;sulfur trioxide (PubChem CID 157451766) has the molecular formula C11H11NO7S2 and a molecular weight of 333.34 g/mol. Its IUPAC name is 5-amino-4-methoxynaphthalene-2-sulfonic acid;sulfur trioxide.
| Compound Name | 5-amino-4-methoxynaphthalene-2-sulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 157451766 |
| Molecular Formula | C11H11NO7S2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 5-amino-4-methoxynaphthalene-2-sulfonic acid;sulfur trioxide |
| SMILES | COc1cc(S(=O)(=O)O)cc2cccc(N)c12.O=S(=O)=O |
| InChI | InChI=1S/C11H11NO4S.O3S/c1-16-10-6-8(17(13,14)15)5-7-3-2-4-9(12)11(7)10;1-4(2)3/h2-6H,12H2,1H3,(H,13,14,15); |
| InChIKey | BSWPZZSSCWOPRL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|