8-amino-3-hydroxynaphthalene-1,2-disulfonic acid

C10H9NO7S2 — CID 174828574

IUPAC8-amino-3-hydroxynaphthalene-1,2-disulfonic acid
SMILESNc1cccc2cc(O)c(S(=O)(=O)O)c(S(=O)(=O)O)c12
InChIInChI=1S/C10H9NO7S2/c11-6-3-1-2-5-4-7(12)9(19(13,14)15)10(8(5)6)20(16,17)18/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18)
InChIKeyCVEDQDFFJMSZAS-UHFFFAOYSA-N
MW319.32 g/mol
LogP0.62
Rot. Bonds2

About 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid

8-amino-3-hydroxynaphthalene-1,2-disulfonic acid (PubChem CID 174828574) has the molecular formula C10H9NO7S2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid.

Molecular Properties

Compound Name8-amino-3-hydroxynaphthalene-1,2-disulfonic acid
PubChem CID174828574
Molecular FormulaC10H9NO7S2
Molecular Weight319.32 g/mol
Exact Mass318.98
IUPAC Name8-amino-3-hydroxynaphthalene-1,2-disulfonic acid
SMILESNc1cccc2cc(O)c(S(=O)(=O)O)c(S(=O)(=O)O)c12
InChIInChI=1S/C10H9NO7S2/c11-6-3-1-2-5-4-7(12)9(19(13,14)15)10(8(5)6)20(16,17)18/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18)
InChIKeyCVEDQDFFJMSZAS-UHFFFAOYSA-N
XLogP0.62
TPSA154.99 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.32
LogP ≤ 50.62
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid?
The IUPAC name of 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid (CID 174828574) is 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid.
What is the SMILES notation for 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid?
The canonical SMILES for 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid is Nc1cccc2cc(O)c(S(=O)(=O)O)c(S(=O)(=O)O)c12.
What is the InChIKey of 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid?
The InChIKey is CVEDQDFFJMSZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO7S2/c11-6-3-1-2-5-4-7(12)9(19(13,14)15)10(8(5)6)20(16,17)18/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18).
What are the key properties of 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid?
8-amino-3-hydroxynaphthalene-1,2-disulfonic acid has a molecular weight of 319.32 g/mol, XLogP of 0.62, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-3-hydroxynaphthalene-1,2-disulfonic acid is sourced from PubChem (CID 174828574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).