C20H15N3O10S3 — CID 163748081
8-amino-4-hydroxy-5-[(8-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide (PubChem CID 163748081) has the molecular formula C20H15N3O10S3 and a molecular weight of 553.55 g/mol. Its IUPAC name is 8-amino-4-hydroxy-5-[(8-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide.
| Compound Name | 8-amino-4-hydroxy-5-[(8-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 163748081 |
| Molecular Formula | C20H15N3O10S3 |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 552.99 |
| IUPAC Name | 8-amino-4-hydroxy-5-[(8-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid;sulfur trioxide |
| SMILES | Nc1ccc(/N=N/c2ccc3cccc(S(=O)(=O)O)c3c2)c2c(O)cc(S(=O)(=O)O)cc12.O=S(=O)=O |
| InChI | InChI=1S/C20H15N3O7S2.O3S/c21-16-6-7-17(20-15(16)9-13(10-18(20)24)31(25,26)27)23-22-12-5-4-11-2-1-3-19(14(11)8-12)32(28,29)30;1-4(2)3/h1-10,24H,21H2,(H,25,26,27)(H,28,29,30);/b23-22+; |
| InChIKey | LNPWLQPRNSMSSX-PGCQSHBKSA-N |
| XLogP | 3.19 |
| TPSA | 230.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|