C10H10N2O7S2 — CID 143119563
3,4-diamino-5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 143119563) has the molecular formula C10H10N2O7S2 and a molecular weight of 334.33 g/mol. Its IUPAC name is 3,4-diamino-5-hydroxynaphthalene-1,7-disulfonic acid.
| Compound Name | 3,4-diamino-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 143119563 |
| Molecular Formula | C10H10N2O7S2 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 3,4-diamino-5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(O)c2c1N |
| InChI | InChI=1S/C10H10N2O7S2/c11-6-3-8(21(17,18)19)5-1-4(20(14,15)16)2-7(13)9(5)10(6)12/h1-3,13H,11-12H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | GAKCLDXTINRKMD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|