C7H7NO9S2 — CID 87517544
4-carbamoyloxy-5-hydroxybenzene-1,3-disulfonic acid (PubChem CID 87517544) has the molecular formula C7H7NO9S2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 4-carbamoyloxy-5-hydroxybenzene-1,3-disulfonic acid.
| Compound Name | 4-carbamoyloxy-5-hydroxybenzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 87517544 |
| Molecular Formula | C7H7NO9S2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 4-carbamoyloxy-5-hydroxybenzene-1,3-disulfonic acid |
| SMILES | NC(=O)Oc1c(O)cc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C7H7NO9S2/c8-7(10)17-6-4(9)1-3(18(11,12)13)2-5(6)19(14,15)16/h1-2,9H,(H2,8,10)(H,11,12,13)(H,14,15,16) |
| InChIKey | FHWILSCPMJOMSK-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 181.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|