C12H12N2O7S2 — CID 154351656
7-acetyl-3,4-diaminonaphthalene-1,5-disulfonic acid (PubChem CID 154351656) has the molecular formula C12H12N2O7S2 and a molecular weight of 360.37 g/mol. Its IUPAC name is 7-acetyl-3,4-diaminonaphthalene-1,5-disulfonic acid.
| Compound Name | 7-acetyl-3,4-diaminonaphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 154351656 |
| Molecular Formula | C12H12N2O7S2 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 7-acetyl-3,4-diaminonaphthalene-1,5-disulfonic acid |
| SMILES | CC(=O)c1cc(S(=O)(=O)O)c2c(N)c(N)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C12H12N2O7S2/c1-5(15)6-2-7-9(22(16,17)18)4-8(13)12(14)11(7)10(3-6)23(19,20)21/h2-4H,13-14H2,1H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | IOAHEXIUJRUNOX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 177.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|