C14H13NO7S2 — CID 173340747
6-acetyl-7-amino-5-ethenylnaphthalene-1,3-disulfonic acid (PubChem CID 173340747) has the molecular formula C14H13NO7S2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 6-acetyl-7-amino-5-ethenylnaphthalene-1,3-disulfonic acid.
| Compound Name | 6-acetyl-7-amino-5-ethenylnaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 173340747 |
| Molecular Formula | C14H13NO7S2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 6-acetyl-7-amino-5-ethenylnaphthalene-1,3-disulfonic acid |
| SMILES | C=Cc1c(C(C)=O)c(N)cc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C14H13NO7S2/c1-3-9-10-4-8(23(17,18)19)5-13(24(20,21)22)11(10)6-12(15)14(9)7(2)16/h3-6H,1,15H2,2H3,(H,17,18,19)(H,20,21,22) |
| InChIKey | XNGFDPFCTWRWOE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|