C20H16N2O12S3 — CID 175422950
3-amino-4-(3-amino-4,5-dihydroxynaphthalen-2-yl)sulfonyloxy-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 175422950) has the molecular formula C20H16N2O12S3 and a molecular weight of 572.55 g/mol. Its IUPAC name is 3-amino-4-(3-amino-4,5-dihydroxynaphthalen-2-yl)sulfonyloxy-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-amino-4-(3-amino-4,5-dihydroxynaphthalen-2-yl)sulfonyloxy-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 175422950 |
| Molecular Formula | C20H16N2O12S3 |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | 3-amino-4-(3-amino-4,5-dihydroxynaphthalen-2-yl)sulfonyloxy-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(S(=O)(=O)Oc2c(N)c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(O)c23)cc2cccc(O)c2c1O |
| InChI | InChI=1S/C20H16N2O12S3/c21-17-14(5-8-2-1-3-11(23)15(8)19(17)25)37(32,33)34-20-16-9(6-13(18(20)22)36(29,30)31)4-10(7-12(16)24)35(26,27)28/h1-7,23-25H,21-22H2,(H,26,27,28)(H,29,30,31) |
| InChIKey | BXZJJLWCYPEFPQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 264.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|