C17H11Cl2NO8S2 — CID 20578281
5-[(2,4-dichlorobenzoyl)amino]-4-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 20578281) has the molecular formula C17H11Cl2NO8S2 and a molecular weight of 492.31 g/mol. Its IUPAC name is 5-[(2,4-dichlorobenzoyl)amino]-4-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 5-[(2,4-dichlorobenzoyl)amino]-4-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 20578281 |
| Molecular Formula | C17H11Cl2NO8S2 |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 490.93 |
| IUPAC Name | 5-[(2,4-dichlorobenzoyl)amino]-4-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1cc(SOOO)cc2cc(S(=O)(=O)O)cc(O)c12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2NO8S2/c18-9-1-2-12(13(19)5-9)17(22)20-14-6-10(29-28-27-23)3-8-4-11(30(24,25)26)7-15(21)16(8)14/h1-7,21,23H,(H,20,22)(H,24,25,26) |
| InChIKey | QLHQMFYKCOIOQA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|