C28H21N3O8S2 — CID 20605078
5-[[3-amino-5-[[6-(trioxidanylsulfanyl)naphthalen-1-yl]carbamoyl]benzoyl]amino]naphthalene-2-sulfonic acid (PubChem CID 20605078) has the molecular formula C28H21N3O8S2 and a molecular weight of 591.62 g/mol. Its IUPAC name is 5-[[3-amino-5-[[6-(trioxidanylsulfanyl)naphthalen-1-yl]carbamoyl]benzoyl]amino]naphthalene-2-sulfonic acid.
| Compound Name | 5-[[3-amino-5-[[6-(trioxidanylsulfanyl)naphthalen-1-yl]carbamoyl]benzoyl]amino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 20605078 |
| Molecular Formula | C28H21N3O8S2 |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | 5-[[3-amino-5-[[6-(trioxidanylsulfanyl)naphthalen-1-yl]carbamoyl]benzoyl]amino]naphthalene-2-sulfonic acid |
| SMILES | Nc1cc(C(=O)Nc2cccc3cc(SOOO)ccc23)cc(C(=O)Nc2cccc3cc(S(=O)(=O)O)ccc23)c1 |
| InChI | InChI=1S/C28H21N3O8S2/c29-20-12-18(27(32)30-25-5-1-3-16-14-21(40-39-38-34)7-9-23(16)25)11-19(13-20)28(33)31-26-6-2-4-17-15-22(41(35,36)37)8-10-24(17)26/h1-15,34H,29H2,(H,30,32)(H,31,33)(H,35,36,37) |
| InChIKey | ADDYVWLYWTUOIZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 177.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|