C12H12N2O6S3 — CID 59940226
5-(methylcarbamothioylamino)-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 59940226) has the molecular formula C12H12N2O6S3 and a molecular weight of 376.44 g/mol. Its IUPAC name is 5-(methylcarbamothioylamino)-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 5-(methylcarbamothioylamino)-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 59940226 |
| Molecular Formula | C12H12N2O6S3 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 5-(methylcarbamothioylamino)-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | CNC(=S)Nc1cc(SOOO)cc2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C12H12N2O6S3/c1-13-12(21)14-11-6-8(22-20-19-15)4-7-5-9(23(16,17)18)2-3-10(7)11/h2-6,15H,1H3,(H2,13,14,21)(H,16,17,18) |
| InChIKey | HFTPEKXWMBPKQJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|