C16H13NO7S2 — CID 23524189
3-[[8-hydroxy-6-(trioxidanylsulfanyl)naphthalen-2-yl]amino]benzenesulfonic acid (PubChem CID 23524189) has the molecular formula C16H13NO7S2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 3-[[8-hydroxy-6-(trioxidanylsulfanyl)naphthalen-2-yl]amino]benzenesulfonic acid.
| Compound Name | 3-[[8-hydroxy-6-(trioxidanylsulfanyl)naphthalen-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 23524189 |
| Molecular Formula | C16H13NO7S2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 3-[[8-hydroxy-6-(trioxidanylsulfanyl)naphthalen-2-yl]amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(Nc2ccc3cc(SOOO)cc(O)c3c2)c1 |
| InChI | InChI=1S/C16H13NO7S2/c18-16-9-13(25-24-23-19)6-10-4-5-12(8-15(10)16)17-11-2-1-3-14(7-11)26(20,21)22/h1-9,17-19H,(H,20,21,22) |
| InChIKey | POHWOSSLABCOSX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|