C18H17NO7S2 — CID 20727148
4-methoxy-3-methyl-6-(3-sulfoanilino)naphthalene-2-sulfonic acid (PubChem CID 20727148) has the molecular formula C18H17NO7S2 and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-methoxy-3-methyl-6-(3-sulfoanilino)naphthalene-2-sulfonic acid.
| Compound Name | 4-methoxy-3-methyl-6-(3-sulfoanilino)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 20727148 |
| Molecular Formula | C18H17NO7S2 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 4-methoxy-3-methyl-6-(3-sulfoanilino)naphthalene-2-sulfonic acid |
| SMILES | COc1c(C)c(S(=O)(=O)O)cc2ccc(Nc3cccc(S(=O)(=O)O)c3)cc12 |
| InChI | InChI=1S/C18H17NO7S2/c1-11-17(28(23,24)25)8-12-6-7-14(10-16(12)18(11)26-2)19-13-4-3-5-15(9-13)27(20,21)22/h3-10,19H,1-2H3,(H,20,21,22)(H,23,24,25) |
| InChIKey | XQQRMSIWWYZKSQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|