C34H25Cl2N5O10S2 — CID 137002050
7-[[6-[(3-chloro-2-hydroxyphenyl)diazenyl]-5-methoxynaphthalen-2-yl]amino]-3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-4-methoxynaphthalene-2-sulfonic acid (PubChem CID 137002050) has the molecular formula C34H25Cl2N5O10S2 and a molecular weight of 798.64 g/mol. Its IUPAC name is 7-[[6-[(3-chloro-2-hydroxyphenyl)diazenyl]-5-methoxynaphthalen-2-yl]amino]-3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-4-methoxynaphthalene-2-sulfonic acid.
| Compound Name | 7-[[6-[(3-chloro-2-hydroxyphenyl)diazenyl]-5-methoxynaphthalen-2-yl]amino]-3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-4-methoxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137002050 |
| Molecular Formula | C34H25Cl2N5O10S2 |
| Molecular Weight | 798.64 g/mol |
| Exact Mass | 797.04 |
| IUPAC Name | 7-[[6-[(3-chloro-2-hydroxyphenyl)diazenyl]-5-methoxynaphthalen-2-yl]amino]-3-[(3-chloro-2-hydroxy-5-sulfophenyl)diazenyl]-4-methoxynaphthalene-2-sulfonic acid |
| SMILES | COc1c(/N=N/c2cccc(Cl)c2O)ccc2cc(Nc3ccc4c(OC)c(/N=N/c5cc(S(=O)(=O)O)cc(Cl)c5O)c(S(=O)(=O)O)cc4c3)ccc12 |
| InChI | InChI=1S/C34H25Cl2N5O10S2/c1-50-33-22-9-7-19(12-17(22)6-11-27(33)39-38-26-5-3-4-24(35)31(26)42)37-20-8-10-23-18(13-20)14-29(53(47,48)49)30(34(23)51-2)41-40-28-16-21(52(44,45)46)15-25(36)32(28)43/h3-16,37,42-43H,1-2H3,(H,44,45,46)(H,47,48,49)/b39-38+,41-40+ |
| InChIKey | UHHFLKZZUPMUKW-VJETXLNASA-N |
| XLogP | 9.80 |
| TPSA | 229.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.64 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|