C33H34N2O10S2 — CID 157188673
3-[[5,8-dihydroxy-9,10-dioxo-4-(2,4,6-trimethyl-3-sulfoanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonic acid;methane (PubChem CID 157188673) has the molecular formula C33H34N2O10S2 and a molecular weight of 682.77 g/mol. Its IUPAC name is 3-[[5,8-dihydroxy-9,10-dioxo-4-(2,4,6-trimethyl-3-sulfoanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonic acid;methane.
| Compound Name | 3-[[5,8-dihydroxy-9,10-dioxo-4-(2,4,6-trimethyl-3-sulfoanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonic acid;methane |
|---|---|
| PubChem CID | 157188673 |
| Molecular Formula | C33H34N2O10S2 |
| Molecular Weight | 682.77 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | 3-[[5,8-dihydroxy-9,10-dioxo-4-(2,4,6-trimethyl-3-sulfoanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonic acid;methane |
| SMILES | C.Cc1cc(C)c(S(=O)(=O)O)c(C)c1Nc1ccc(Nc2c(C)cc(C)c(S(=O)(=O)O)c2C)c2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C32H30N2O10S2.CH4/c1-13-11-15(3)31(45(39,40)41)17(5)27(13)33-19-7-8-20(34-28-14(2)12-16(4)32(18(28)6)46(42,43)44)24-23(19)29(37)25-21(35)9-10-22(36)26(25)30(24)38;/h7-12,33-36H,1-6H3,(H,39,40,41)(H,42,43,44);1H4 |
| InChIKey | APKXNLJYZFDQLL-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|