C23H15BrN2O5S — CID 59979948
12-bromo-14-methyl-10-[2-(trioxidanylsulfanyl)anilino]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione (PubChem CID 59979948) has the molecular formula C23H15BrN2O5S and a molecular weight of 511.35 g/mol. Its IUPAC name is 12-bromo-14-methyl-10-[2-(trioxidanylsulfanyl)anilino]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione.
| Compound Name | 12-bromo-14-methyl-10-[2-(trioxidanylsulfanyl)anilino]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione |
|---|---|
| PubChem CID | 59979948 |
| Molecular Formula | C23H15BrN2O5S |
| Molecular Weight | 511.35 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | 12-bromo-14-methyl-10-[2-(trioxidanylsulfanyl)anilino]-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-8,15-dione |
| SMILES | Cn1c(=O)cc2c3c(c(Nc4ccccc4SOOO)cc(Br)c31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H15BrN2O5S/c1-26-19(27)10-14-12-6-2-3-7-13(12)23(28)21-17(11-15(24)22(26)20(14)21)25-16-8-4-5-9-18(16)32-31-30-29/h2-11,25,29H,1H3 |
| InChIKey | SSESCQVVMPWDBC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.35 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|