C26H30N2O2 — CID 123846768
10-(3,5-dimethylheptan-3-ylamino)-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione (PubChem CID 123846768) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 10-(3,5-dimethylheptan-3-ylamino)-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione.
| Compound Name | 10-(3,5-dimethylheptan-3-ylamino)-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
|---|---|
| PubChem CID | 123846768 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 10-(3,5-dimethylheptan-3-ylamino)-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
| SMILES | CCC(C)CC(C)(CC)Nc1ccc2c3c(cc(=O)n2C)-c2ccccc2C(=O)c13 |
| InChI | InChI=1S/C26H30N2O2/c1-6-16(3)15-26(4,7-2)27-20-12-13-21-23-19(14-22(29)28(21)5)17-10-8-9-11-18(17)25(30)24(20)23/h8-14,16,27H,6-7,15H2,1-5H3 |
| InChIKey | SNZUEAQGWDFKSC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|