C27H17ClN2O3 — CID 101061338
12-(4-chlorophenoxy)-10-(4-methylanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 101061338) has the molecular formula C27H17ClN2O3 and a molecular weight of 452.90 g/mol. Its IUPAC name is 12-(4-chlorophenoxy)-10-(4-methylanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-(4-chlorophenoxy)-10-(4-methylanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 101061338 |
| Molecular Formula | C27H17ClN2O3 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 12-(4-chlorophenoxy)-10-(4-methylanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | Cc1ccc(Nc2cc(Oc3ccc(Cl)cc3)c3noc4c3c2C(=O)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C27H17ClN2O3/c1-15-6-10-17(11-7-15)29-21-14-22(32-18-12-8-16(28)9-13-18)25-24-23(21)26(31)19-4-2-3-5-20(19)27(24)33-30-25/h2-14,29H,1H3 |
| InChIKey | BCXBYSNLMOMTMV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|