C32H26ClFN4O3 — CID 46504400
12-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-10-(3-fluoroanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 46504400) has the molecular formula C32H26ClFN4O3 and a molecular weight of 569.04 g/mol. Its IUPAC name is 12-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-10-(3-fluoroanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-10-(3-fluoroanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 46504400 |
| Molecular Formula | C32H26ClFN4O3 |
| Molecular Weight | 569.04 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 12-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-10-(3-fluoroanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | O=C1c2ccccc2-c2onc3c(N4CCN(CCOc5ccc(Cl)cc5)CC4)cc(Nc4cccc(F)c4)c1c23 |
| InChI | InChI=1S/C32H26ClFN4O3/c33-20-8-10-23(11-9-20)40-17-16-37-12-14-38(15-13-37)27-19-26(35-22-5-3-4-21(34)18-22)28-29-30(27)36-41-32(29)25-7-2-1-6-24(25)31(28)39/h1-11,18-19,35H,12-17H2 |
| InChIKey | QMNMMYLZSVJTSW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.04 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|