C36H36N4O6 — CID 46504387
10-(4-ethoxyanilino)-12-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 46504387) has the molecular formula C36H36N4O6 and a molecular weight of 620.71 g/mol. Its IUPAC name is 10-(4-ethoxyanilino)-12-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 10-(4-ethoxyanilino)-12-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 46504387 |
| Molecular Formula | C36H36N4O6 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 10-(4-ethoxyanilino)-12-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | CCOc1ccc(Nc2cc(N3CCN(Cc4ccc(OC)c(OC)c4OC)CC3)c3noc4c3c2C(=O)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C36H36N4O6/c1-5-45-24-13-11-23(12-14-24)37-27-20-28(32-31-30(27)33(41)25-8-6-7-9-26(25)35(31)46-38-32)40-18-16-39(17-19-40)21-22-10-15-29(42-2)36(44-4)34(22)43-3/h6-15,20,37H,5,16-19,21H2,1-4H3 |
| InChIKey | JYXDXTPFXRAHAB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|