C34H33ClN5O3+ — CID 3665712
12-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-10-[4-(dimethylamino)anilino]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 3665712) has the molecular formula C34H33ClN5O3+ and a molecular weight of 595.12 g/mol. Its IUPAC name is 12-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-10-[4-(dimethylamino)anilino]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-10-[4-(dimethylamino)anilino]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 3665712 |
| Molecular Formula | C34H33ClN5O3+ |
| Molecular Weight | 595.12 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | 12-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-4-ium-1-yl]-10-[4-(dimethylamino)anilino]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | COc1ccc(Cl)cc1C[NH+]1CCN(c2cc(Nc3ccc(N(C)C)cc3)c3c4c(onc24)-c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C34H32ClN5O3/c1-38(2)24-11-9-23(10-12-24)36-27-19-28(32-31-30(27)33(41)25-6-4-5-7-26(25)34(31)43-37-32)40-16-14-39(15-17-40)20-21-18-22(35)8-13-29(21)42-3/h4-13,18-19,36H,14-17,20H2,1-3H3/p+1 |
| InChIKey | BJBPZUVIZXVENP-UHFFFAOYSA-O |
| XLogP | 5.42 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.12 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|