C32H33N4O4+ — CID 3625539
methyl 4-[[12-(4-cyclohexylpiperazin-4-ium-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate (PubChem CID 3625539) has the molecular formula C32H33N4O4+ and a molecular weight of 537.64 g/mol. Its IUPAC name is methyl 4-[[12-(4-cyclohexylpiperazin-4-ium-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate.
| Compound Name | methyl 4-[[12-(4-cyclohexylpiperazin-4-ium-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
|---|---|
| PubChem CID | 3625539 |
| Molecular Formula | C32H33N4O4+ |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | methyl 4-[[12-(4-cyclohexylpiperazin-4-ium-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cc(N3CC[NH+](C4CCCCC4)CC3)c3noc4c3c2C(=O)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C32H32N4O4/c1-39-32(38)20-11-13-21(14-12-20)33-25-19-26(36-17-15-35(16-18-36)22-7-3-2-4-8-22)29-28-27(25)30(37)23-9-5-6-10-24(23)31(28)40-34-29/h5-6,9-14,19,22,33H,2-4,7-8,15-18H2,1H3/p+1 |
| InChIKey | MEHKXGDAMQKVMG-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|