C33H34N4O4 — CID 3618499
ethyl 3-[[12-(4-cyclohexylpiperazin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate (PubChem CID 3618499) has the molecular formula C33H34N4O4 and a molecular weight of 550.66 g/mol. Its IUPAC name is ethyl 3-[[12-(4-cyclohexylpiperazin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate.
| Compound Name | ethyl 3-[[12-(4-cyclohexylpiperazin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
|---|---|
| PubChem CID | 3618499 |
| Molecular Formula | C33H34N4O4 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | ethyl 3-[[12-(4-cyclohexylpiperazin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2cc(N3CCN(C4CCCCC4)CC3)c3noc4c3c2C(=O)c2ccccc2-4)c1 |
| InChI | InChI=1S/C33H34N4O4/c1-2-40-33(39)21-9-8-10-22(19-21)34-26-20-27(37-17-15-36(16-18-37)23-11-4-3-5-12-23)30-29-28(26)31(38)24-13-6-7-14-25(24)32(29)41-35-30/h6-10,13-14,19-20,23,34H,2-5,11-12,15-18H2,1H3 |
| InChIKey | QXXYHKGBBVBLDG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|